C21H32O3 — CID 140807720
2-ethylhexyl 3-[2-[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoate (PubChem CID 140807720) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 2-ethylhexyl 3-[2-[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoate.
| Compound Name | 2-ethylhexyl 3-[2-[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140807720 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 2-ethylhexyl 3-[2-[(2-methylpropan-2-yl)oxy]phenyl]prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)C=Cc1ccccc1OC(C)(C)C |
| InChI | InChI=1S/C21H32O3/c1-6-8-11-17(7-2)16-23-20(22)15-14-18-12-9-10-13-19(18)24-21(3,4)5/h9-10,12-15,17H,6-8,11,16H2,1-5H3 |
| InChIKey | NVOLCCCIARWMKC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|