C25H23NO2 — CID 162228453
nona-1,3,5,7-tetraynyl (2E,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate (PubChem CID 162228453) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is nona-1,3,5,7-tetraynyl (2E,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate.
| Compound Name | nona-1,3,5,7-tetraynyl (2E,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 162228453 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | nona-1,3,5,7-tetraynyl (2E,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate |
| SMILES | CC#CC#CC#CC#COC(=O)/C(=C/C=C/N(CC)CC)Cc1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c1-4-7-8-9-10-11-15-21-28-25(27)24(19-16-20-26(5-2)6-3)22-23-17-13-12-14-18-23/h12-14,16-20H,5-6,22H2,1-3H3/b20-16+,24-19+ |
| InChIKey | ZPPFNEMHMXIUMU-ZXSXZIHDSA-N |
| XLogP | 3.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|