C17H17N3O2 — CID 89309179
benzyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-ethylamino]acetate (PubChem CID 89309179) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is benzyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-ethylamino]acetate.
| Compound Name | benzyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-ethylamino]acetate |
|---|---|
| PubChem CID | 89309179 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | benzyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-ethylamino]acetate |
| SMILES | CCN(/C=C/C=C(C#N)C#N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c1-2-20(10-6-9-16(11-18)12-19)13-17(21)22-14-15-7-4-3-5-8-15/h3-10H,2,13-14H2,1H3/b10-6+ |
| InChIKey | WJVGYMJWJDDQLT-UXBLZVDNSA-N |
| XLogP | 2.54 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|