C20H23N3O2 — CID 89309153
2-[butyl-[(1E)-4,4-dicyanobuta-1,3-dienyl]amino]ethyl 2-phenylacetate (PubChem CID 89309153) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[butyl-[(1E)-4,4-dicyanobuta-1,3-dienyl]amino]ethyl 2-phenylacetate.
| Compound Name | 2-[butyl-[(1E)-4,4-dicyanobuta-1,3-dienyl]amino]ethyl 2-phenylacetate |
|---|---|
| PubChem CID | 89309153 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-[butyl-[(1E)-4,4-dicyanobuta-1,3-dienyl]amino]ethyl 2-phenylacetate |
| SMILES | CCCCN(/C=C/C=C(C#N)C#N)CCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-3-11-23(12-7-10-19(16-21)17-22)13-14-25-20(24)15-18-8-5-4-6-9-18/h4-10,12H,2-3,11,13-15H2,1H3/b12-7+ |
| InChIKey | QTNMXYNUMFRBPP-KPKJPENVSA-N |
| XLogP | 3.36 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|