C26H24N6O4 — CID 89309917
bis[2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]ethyl] benzene-1,4-dicarboxylate (PubChem CID 89309917) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is bis[2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]ethyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89309917 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | bis[2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]ethyl] benzene-1,4-dicarboxylate |
| SMILES | CN(/C=C/C=C(C#N)C#N)CCOC(=O)c1ccc(C(=O)OCCN(C)/C=C/C=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C26H24N6O4/c1-31(11-3-5-21(17-27)18-28)13-15-35-25(33)23-7-9-24(10-8-23)26(34)36-16-14-32(2)12-4-6-22(19-29)20-30/h3-12H,13-16H2,1-2H3/b11-3+,12-4+ |
| InChIKey | HEIXMJAGFMDEES-HMMKTVFPSA-N |
| XLogP | 2.84 |
| TPSA | 154.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|