C17H17N3O3 — CID 89309176
2-phenoxyethyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]acetate (PubChem CID 89309176) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]acetate.
| Compound Name | 2-phenoxyethyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]acetate |
|---|---|
| PubChem CID | 89309176 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-phenoxyethyl 2-[[(1E)-4,4-dicyanobuta-1,3-dienyl]-methylamino]acetate |
| SMILES | CN(/C=C/C=C(C#N)C#N)CC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C17H17N3O3/c1-20(9-5-6-15(12-18)13-19)14-17(21)23-11-10-22-16-7-3-2-4-8-16/h2-9H,10-11,14H2,1H3/b9-5+ |
| InChIKey | GUUYJDHLLYIGBB-WEVVVXLNSA-N |
| XLogP | 2.03 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|