About 2-phenoxyethyl 2-oxobutanoate
2-phenoxyethyl 2-oxobutanoate (PubChem CID 71400908) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-phenoxyethyl 2-oxobutanoate.
Molecular Properties
| Compound Name | 2-phenoxyethyl 2-oxobutanoate |
| PubChem CID | 71400908 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-phenoxyethyl 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C12H14O4/c1-2-11(13)12(14)16-9-8-15-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | KZTUFJMTKNFKIJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl 2-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl 2-oxobutanoate?
The IUPAC name of 2-phenoxyethyl 2-oxobutanoate (CID 71400908) is 2-phenoxyethyl 2-oxobutanoate.
What is the SMILES notation for 2-phenoxyethyl 2-oxobutanoate?
The canonical SMILES for 2-phenoxyethyl 2-oxobutanoate is CCC(=O)C(=O)OCCOc1ccccc1.
What is the InChIKey of 2-phenoxyethyl 2-oxobutanoate?
The InChIKey is KZTUFJMTKNFKIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-2-11(13)12(14)16-9-8-15-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3.
What are the key properties of 2-phenoxyethyl 2-oxobutanoate?
2-phenoxyethyl 2-oxobutanoate has a molecular weight of 222.24 g/mol, XLogP of 1.59, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl 2-oxobutanoate is sourced from PubChem (CID 71400908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).