About propyl 3-phenoxypropanoate
propyl 3-phenoxypropanoate (PubChem CID 43389568) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is propyl 3-phenoxypropanoate.
Molecular Properties
| Compound Name | propyl 3-phenoxypropanoate |
| PubChem CID | 43389568 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | propyl 3-phenoxypropanoate |
| SMILES | CCCOC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C12H16O3/c1-2-9-15-12(13)8-10-14-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | MFFADZBBCNESQN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 3-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-phenoxypropanoate?
The IUPAC name of propyl 3-phenoxypropanoate (CID 43389568) is propyl 3-phenoxypropanoate.
What is the SMILES notation for propyl 3-phenoxypropanoate?
The canonical SMILES for propyl 3-phenoxypropanoate is CCCOC(=O)CCOc1ccccc1.
What is the InChIKey of propyl 3-phenoxypropanoate?
The InChIKey is MFFADZBBCNESQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-2-9-15-12(13)8-10-14-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3.
What are the key properties of propyl 3-phenoxypropanoate?
propyl 3-phenoxypropanoate has a molecular weight of 208.26 g/mol, XLogP of 2.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-phenoxypropanoate is sourced from PubChem (CID 43389568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).