About acetamido 3-phenoxypropanoate
acetamido 3-phenoxypropanoate (PubChem CID 57060958) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is acetamido 3-phenoxypropanoate.
Molecular Properties
| Compound Name | acetamido 3-phenoxypropanoate |
| PubChem CID | 57060958 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | acetamido 3-phenoxypropanoate |
| SMILES | CC(=O)NOC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C11H13NO4/c1-9(13)12-16-11(14)7-8-15-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,12,13) |
| InChIKey | OZJJSLJXKBQVJB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetamido 3-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamido 3-phenoxypropanoate?
The IUPAC name of acetamido 3-phenoxypropanoate (CID 57060958) is acetamido 3-phenoxypropanoate.
What is the SMILES notation for acetamido 3-phenoxypropanoate?
The canonical SMILES for acetamido 3-phenoxypropanoate is CC(=O)NOC(=O)CCOc1ccccc1.
What is the InChIKey of acetamido 3-phenoxypropanoate?
The InChIKey is OZJJSLJXKBQVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-9(13)12-16-11(14)7-8-15-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,12,13).
What are the key properties of acetamido 3-phenoxypropanoate?
acetamido 3-phenoxypropanoate has a molecular weight of 223.23 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamido 3-phenoxypropanoate is sourced from PubChem (CID 57060958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).