C14H17NO6 — CID 7841440
[2-(ethoxycarbonylamino)-2-oxoethyl] 3-phenoxypropanoate (PubChem CID 7841440) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 3-phenoxypropanoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-phenoxypropanoate |
|---|---|
| PubChem CID | 7841440 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-phenoxypropanoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C14H17NO6/c1-2-19-14(18)15-12(16)10-21-13(17)8-9-20-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,15,16,18) |
| InChIKey | BHUFJENMKUMPOM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |