C14H20O3 — CID 78862887
propyl 3-(2,6-dimethylphenoxy)propanoate (PubChem CID 78862887) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is propyl 3-(2,6-dimethylphenoxy)propanoate.
| Compound Name | propyl 3-(2,6-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 78862887 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | propyl 3-(2,6-dimethylphenoxy)propanoate |
| SMILES | CCCOC(=O)CCOc1c(C)cccc1C |
| InChI | InChI=1S/C14H20O3/c1-4-9-16-13(15)8-10-17-14-11(2)6-5-7-12(14)3/h5-7H,4,8-10H2,1-3H3 |
| InChIKey | MGMFELWVCWHJOL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |