C13H18O3 — CID 43173798
ethyl 3-(2,6-dimethylphenoxy)propanoate (PubChem CID 43173798) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is ethyl 3-(2,6-dimethylphenoxy)propanoate.
| Compound Name | ethyl 3-(2,6-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 43173798 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | ethyl 3-(2,6-dimethylphenoxy)propanoate |
| SMILES | CCOC(=O)CCOc1c(C)cccc1C |
| InChI | InChI=1S/C13H18O3/c1-4-15-12(14)8-9-16-13-10(2)6-5-7-11(13)3/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | WJLHFFIXWMLXKA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |