C11H11I3O3 — CID 43174164
ethyl 3-(2,4,6-triiodophenoxy)propanoate (PubChem CID 43174164) has the molecular formula C11H11I3O3 and a molecular weight of 571.92 g/mol. Its IUPAC name is ethyl 3-(2,4,6-triiodophenoxy)propanoate.
| Compound Name | ethyl 3-(2,4,6-triiodophenoxy)propanoate |
|---|---|
| PubChem CID | 43174164 |
| Molecular Formula | C11H11I3O3 |
| Molecular Weight | 571.92 g/mol |
| Exact Mass | 571.78 |
| IUPAC Name | ethyl 3-(2,4,6-triiodophenoxy)propanoate |
| SMILES | CCOC(=O)CCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C11H11I3O3/c1-2-16-10(15)3-4-17-11-8(13)5-7(12)6-9(11)14/h5-6H,2-4H2,1H3 |
| InChIKey | DVWOATLZBVEXFF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.92 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|