C14H12Cl2INO3 — CID 83172289
ethyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate (PubChem CID 83172289) has the molecular formula C14H12Cl2INO3 and a molecular weight of 440.06 g/mol. Its IUPAC name is ethyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate.
| Compound Name | ethyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate |
|---|---|
| PubChem CID | 83172289 |
| Molecular Formula | C14H12Cl2INO3 |
| Molecular Weight | 440.06 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | ethyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate |
| SMILES | CCOC(=O)CCOc1c(I)cc(Cl)c2ccc(Cl)nc12 |
| InChI | InChI=1S/C14H12Cl2INO3/c1-2-20-12(19)5-6-21-14-10(17)7-9(15)8-3-4-11(16)18-13(8)14/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | WMFJZGNTHCSWHE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.06 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|