C12H10Cl2IN3O3 — CID 83172049
hydrazinyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate (PubChem CID 83172049) has the molecular formula C12H10Cl2IN3O3 and a molecular weight of 442.04 g/mol. Its IUPAC name is hydrazinyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate.
| Compound Name | hydrazinyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate |
|---|---|
| PubChem CID | 83172049 |
| Molecular Formula | C12H10Cl2IN3O3 |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 440.91 |
| IUPAC Name | hydrazinyl 3-(2,5-dichloro-7-iodoquinolin-8-yl)oxypropanoate |
| SMILES | NNOC(=O)CCOc1c(I)cc(Cl)c2ccc(Cl)nc12 |
| InChI | InChI=1S/C12H10Cl2IN3O3/c13-7-5-8(15)12(20-4-3-10(19)21-18-16)11-6(7)1-2-9(14)17-11/h1-2,5,18H,3-4,16H2 |
| InChIKey | XHZMKXUACJMOIO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|