C13H10Br2ClNO3 — CID 83224029
methyl 3-(5,7-dibromo-2-chloroquinolin-8-yl)oxypropanoate (PubChem CID 83224029) has the molecular formula C13H10Br2ClNO3 and a molecular weight of 423.49 g/mol. Its IUPAC name is methyl 3-(5,7-dibromo-2-chloroquinolin-8-yl)oxypropanoate.
| Compound Name | methyl 3-(5,7-dibromo-2-chloroquinolin-8-yl)oxypropanoate |
|---|---|
| PubChem CID | 83224029 |
| Molecular Formula | C13H10Br2ClNO3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 420.87 |
| IUPAC Name | methyl 3-(5,7-dibromo-2-chloroquinolin-8-yl)oxypropanoate |
| SMILES | COC(=O)CCOc1c(Br)cc(Br)c2ccc(Cl)nc12 |
| InChI | InChI=1S/C13H10Br2ClNO3/c1-19-11(18)4-5-20-13-9(15)6-8(14)7-2-3-10(16)17-12(7)13/h2-3,6H,4-5H2,1H3 |
| InChIKey | FCPJRNSOKKDAJJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|