C13H13Br2ClN2O — CID 83223674
2-(5,7-dibromo-2-chloroquinolin-8-yl)oxy-N-ethylethanamine (PubChem CID 83223674) has the molecular formula C13H13Br2ClN2O and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-(5,7-dibromo-2-chloroquinolin-8-yl)oxy-N-ethylethanamine.
| Compound Name | 2-(5,7-dibromo-2-chloroquinolin-8-yl)oxy-N-ethylethanamine |
|---|---|
| PubChem CID | 83223674 |
| Molecular Formula | C13H13Br2ClN2O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 2-(5,7-dibromo-2-chloroquinolin-8-yl)oxy-N-ethylethanamine |
| SMILES | CCNCCOc1c(Br)cc(Br)c2ccc(Cl)nc12 |
| InChI | InChI=1S/C13H13Br2ClN2O/c1-2-17-5-6-19-13-10(15)7-9(14)8-3-4-11(16)18-12(8)13/h3-4,7,17H,2,5-6H2,1H3 |
| InChIKey | YTRKFWCWUCTFMT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|