C16H20Br2N2O — CID 62597073
4-(5,7-dibromoquinolin-8-yl)oxy-N-propylbutan-1-amine (PubChem CID 62597073) has the molecular formula C16H20Br2N2O and a molecular weight of 416.16 g/mol. Its IUPAC name is 4-(5,7-dibromoquinolin-8-yl)oxy-N-propylbutan-1-amine.
| Compound Name | 4-(5,7-dibromoquinolin-8-yl)oxy-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 62597073 |
| Molecular Formula | C16H20Br2N2O |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 4-(5,7-dibromoquinolin-8-yl)oxy-N-propylbutan-1-amine |
| SMILES | CCCNCCCCOc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C16H20Br2N2O/c1-2-7-19-8-3-4-10-21-16-14(18)11-13(17)12-6-5-9-20-15(12)16/h5-6,9,11,19H,2-4,7-8,10H2,1H3 |
| InChIKey | VVQQRQNTRSOTPX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|