C14H17BrN2 — CID 112617660
N-[(5-bromoquinolin-8-yl)methyl]butan-1-amine (PubChem CID 112617660) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is N-[(5-bromoquinolin-8-yl)methyl]butan-1-amine.
| Compound Name | N-[(5-bromoquinolin-8-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 112617660 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[(5-bromoquinolin-8-yl)methyl]butan-1-amine |
| SMILES | CCCCNCc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C14H17BrN2/c1-2-3-8-16-10-11-6-7-13(15)12-5-4-9-17-14(11)12/h4-7,9,16H,2-3,8,10H2,1H3 |
| InChIKey | XMFDEAIKWYDAAU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|