C15H19BrN2S — CID 115968069
N-[(5-bromoquinolin-8-yl)methyl]-3-methylsulfanylbutan-1-amine (PubChem CID 115968069) has the molecular formula C15H19BrN2S and a molecular weight of 339.30 g/mol. Its IUPAC name is N-[(5-bromoquinolin-8-yl)methyl]-3-methylsulfanylbutan-1-amine.
| Compound Name | N-[(5-bromoquinolin-8-yl)methyl]-3-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115968069 |
| Molecular Formula | C15H19BrN2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[(5-bromoquinolin-8-yl)methyl]-3-methylsulfanylbutan-1-amine |
| SMILES | CSC(C)CCNCc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C15H19BrN2S/c1-11(19-2)7-9-17-10-12-5-6-14(16)13-4-3-8-18-15(12)13/h3-6,8,11,17H,7,9-10H2,1-2H3 |
| InChIKey | OIHUCZWHJBZBGE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|