C14H15BrN2O2 — CID 112617701
4-[(5-bromoquinolin-8-yl)methylamino]butanoic acid (PubChem CID 112617701) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 4-[(5-bromoquinolin-8-yl)methylamino]butanoic acid.
| Compound Name | 4-[(5-bromoquinolin-8-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 112617701 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-[(5-bromoquinolin-8-yl)methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C14H15BrN2O2/c15-12-6-5-10(9-16-7-2-4-13(18)19)14-11(12)3-1-8-17-14/h1,3,5-6,8,16H,2,4,7,9H2,(H,18,19) |
| InChIKey | FBTLAXQNQIEWGY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|