C15H17BrN2O2 — CID 120510503
(2S)-2-[(5-bromoquinolin-8-yl)methylamino]-3-methylbutanoic acid (PubChem CID 120510503) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is (2S)-2-[(5-bromoquinolin-8-yl)methylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(5-bromoquinolin-8-yl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120510503 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (2S)-2-[(5-bromoquinolin-8-yl)methylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NCc1ccc(Br)c2cccnc12)C(=O)O |
| InChI | InChI=1S/C15H17BrN2O2/c1-9(2)13(15(19)20)18-8-10-5-6-12(16)11-4-3-7-17-14(10)11/h3-7,9,13,18H,8H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | LKVQAZPWSGXEGH-ZDUSSCGKSA-N |
| XLogP | 3.20 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |