C13H13BrN6 — CID 115959259
N-[(5-bromoquinolin-8-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine (PubChem CID 115959259) has the molecular formula C13H13BrN6 and a molecular weight of 333.19 g/mol. Its IUPAC name is N-[(5-bromoquinolin-8-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine.
| Compound Name | N-[(5-bromoquinolin-8-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 115959259 |
| Molecular Formula | C13H13BrN6 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-[(5-bromoquinolin-8-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine |
| SMILES | CC(NCc1ccc(Br)c2cccnc12)c1nn[nH]n1 |
| InChI | InChI=1S/C13H13BrN6/c1-8(13-17-19-20-18-13)16-7-9-4-5-11(14)10-3-2-6-15-12(9)10/h2-6,8,16H,7H2,1H3,(H,17,18,19,20) |
| InChIKey | JJLYDZAJFXVOJT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |