C17H15BrN2O2S — CID 99779424
(3R)-3-[(5-bromoquinolin-8-yl)methylamino]-3-thiophen-3-ylpropanoic acid (PubChem CID 99779424) has the molecular formula C17H15BrN2O2S and a molecular weight of 391.29 g/mol. Its IUPAC name is (3R)-3-[(5-bromoquinolin-8-yl)methylamino]-3-thiophen-3-ylpropanoic acid.
| Compound Name | (3R)-3-[(5-bromoquinolin-8-yl)methylamino]-3-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 99779424 |
| Molecular Formula | C17H15BrN2O2S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | (3R)-3-[(5-bromoquinolin-8-yl)methylamino]-3-thiophen-3-ylpropanoic acid |
| SMILES | O=C(O)C[C@@H](NCc1ccc(Br)c2cccnc12)c1ccsc1 |
| InChI | InChI=1S/C17H15BrN2O2S/c18-14-4-3-11(17-13(14)2-1-6-19-17)9-20-15(8-16(21)22)12-5-7-23-10-12/h1-7,10,15,20H,8-9H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | DJBLQUDNGSATNL-OAHLLOKOSA-N |
| XLogP | 4.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |