C14H13BrFNO2S — CID 99779420
(3R)-3-[(5-bromo-2-fluorophenyl)methylamino]-3-thiophen-3-ylpropanoic acid (PubChem CID 99779420) has the molecular formula C14H13BrFNO2S and a molecular weight of 358.23 g/mol. Its IUPAC name is (3R)-3-[(5-bromo-2-fluorophenyl)methylamino]-3-thiophen-3-ylpropanoic acid.
| Compound Name | (3R)-3-[(5-bromo-2-fluorophenyl)methylamino]-3-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 99779420 |
| Molecular Formula | C14H13BrFNO2S |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | (3R)-3-[(5-bromo-2-fluorophenyl)methylamino]-3-thiophen-3-ylpropanoic acid |
| SMILES | O=C(O)C[C@@H](NCc1cc(Br)ccc1F)c1ccsc1 |
| InChI | InChI=1S/C14H13BrFNO2S/c15-11-1-2-12(16)10(5-11)7-17-13(6-14(18)19)9-3-4-20-8-9/h1-5,8,13,17H,6-7H2,(H,18,19)/t13-/m1/s1 |
| InChIKey | WQHWVVQOFNFLEG-CYBMUJFWSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |