C11H14BrFN2O2 — CID 115241706
3-amino-4-[(5-bromo-2-fluorophenyl)methylamino]butanoic acid (PubChem CID 115241706) has the molecular formula C11H14BrFN2O2 and a molecular weight of 305.15 g/mol. Its IUPAC name is 3-amino-4-[(5-bromo-2-fluorophenyl)methylamino]butanoic acid.
| Compound Name | 3-amino-4-[(5-bromo-2-fluorophenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 115241706 |
| Molecular Formula | C11H14BrFN2O2 |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 3-amino-4-[(5-bromo-2-fluorophenyl)methylamino]butanoic acid |
| SMILES | NC(CNCc1cc(Br)ccc1F)CC(=O)O |
| InChI | InChI=1S/C11H14BrFN2O2/c12-8-1-2-10(13)7(3-8)5-15-6-9(14)4-11(16)17/h1-3,9,15H,4-6,14H2,(H,16,17) |
| InChIKey | IDINMFYONFBYEG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |