C13H14Br2N2O — CID 62597239
4-(5,7-dibromoquinolin-8-yl)oxybutan-1-amine (PubChem CID 62597239) has the molecular formula C13H14Br2N2O and a molecular weight of 374.08 g/mol. Its IUPAC name is 4-(5,7-dibromoquinolin-8-yl)oxybutan-1-amine.
| Compound Name | 4-(5,7-dibromoquinolin-8-yl)oxybutan-1-amine |
|---|---|
| PubChem CID | 62597239 |
| Molecular Formula | C13H14Br2N2O |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 4-(5,7-dibromoquinolin-8-yl)oxybutan-1-amine |
| SMILES | NCCCCOc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C13H14Br2N2O/c14-10-8-11(15)13(18-7-2-1-5-16)12-9(10)4-3-6-17-12/h3-4,6,8H,1-2,5,7,16H2 |
| InChIKey | FDVWADNWNWUTBQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|