C10H7Br2NO — CID 10805403
5,7-dibromo-8-methoxyquinoline (PubChem CID 10805403) has the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. Its IUPAC name is 5,7-dibromo-8-methoxyquinoline.
| Compound Name | 5,7-dibromo-8-methoxyquinoline |
|---|---|
| PubChem CID | 10805403 |
| Molecular Formula | C10H7Br2NO |
| Molecular Weight | 316.98 g/mol |
| Exact Mass | 314.89 |
| IUPAC Name | 5,7-dibromo-8-methoxyquinoline |
| SMILES | COc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C10H7Br2NO/c1-14-10-8(12)5-7(11)6-3-2-4-13-9(6)10/h2-5H,1H3 |
| InChIKey | IJANXCJVULGZRF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |