C13H11Br2NO — CID 4859559
5,7-dibromo-8-but-2-enoxyquinoline (PubChem CID 4859559) has the molecular formula C13H11Br2NO and a molecular weight of 357.05 g/mol. Its IUPAC name is 5,7-dibromo-8-but-2-enoxyquinoline.
| Compound Name | 5,7-dibromo-8-but-2-enoxyquinoline |
|---|---|
| PubChem CID | 4859559 |
| Molecular Formula | C13H11Br2NO |
| Molecular Weight | 357.05 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | 5,7-dibromo-8-but-2-enoxyquinoline |
| SMILES | CC=CCOc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C13H11Br2NO/c1-2-3-7-17-13-11(15)8-10(14)9-5-4-6-16-12(9)13/h2-6,8H,7H2,1H3 |
| InChIKey | VDGWIAIKSWPNEQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.05 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|