C18H14Br2N2O3 — CID 91455867
2-(5,7-dibromoquinolin-8-yl)oxy-N-(2-methoxyphenyl)acetamide (PubChem CID 91455867) has the molecular formula C18H14Br2N2O3 and a molecular weight of 466.13 g/mol. Its IUPAC name is 2-(5,7-dibromoquinolin-8-yl)oxy-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 91455867 |
| Molecular Formula | C18H14Br2N2O3 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C18H14Br2N2O3/c1-24-15-7-3-2-6-14(15)22-16(23)10-25-18-13(20)9-12(19)11-5-4-8-21-17(11)18/h2-9H,10H2,1H3,(H,22,23) |
| InChIKey | VOKMDJDFBHIFMK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |