C21H29NO4Si — CID 91742925
2-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 91742925) has the molecular formula C21H29NO4Si and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 91742925 |
| Molecular Formula | C21H29NO4Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H29NO4Si/c1-21(2,3)27(5,6)26-19-14-10-9-13-18(19)25-15-20(23)22-16-11-7-8-12-17(16)24-4/h7-14H,15H2,1-6H3,(H,22,23) |
| InChIKey | IPTTWNPUWXTQEJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|