C17H19NO4 — CID 3891399
N-(2-ethoxyphenyl)-2-(2-methoxyphenoxy)acetamide (PubChem CID 3891399) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 3891399 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-(2-methoxyphenoxy)acetamide |
| SMILES | CCOc1ccccc1NC(=O)COc1ccccc1OC |
| InChI | InChI=1S/C17H19NO4/c1-3-21-14-9-5-4-8-13(14)18-17(19)12-22-16-11-7-6-10-15(16)20-2/h4-11H,3,12H2,1-2H3,(H,18,19) |
| InChIKey | XESWUHACAFVHHM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |