C17H20ClNO3Si — CID 91696728
N-(2-chlorophenyl)-2-(2-trimethylsilyloxyphenoxy)acetamide (PubChem CID 91696728) has the molecular formula C17H20ClNO3Si and a molecular weight of 349.89 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(2-trimethylsilyloxyphenoxy)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(2-trimethylsilyloxyphenoxy)acetamide |
|---|---|
| PubChem CID | 91696728 |
| Molecular Formula | C17H20ClNO3Si |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(2-chlorophenyl)-2-(2-trimethylsilyloxyphenoxy)acetamide |
| SMILES | C[Si](C)(C)Oc1ccccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H20ClNO3Si/c1-23(2,3)22-16-11-7-6-10-15(16)21-12-17(20)19-14-9-5-4-8-13(14)18/h4-11H,12H2,1-3H3,(H,19,20) |
| InChIKey | XXNPVKCRXBGWLV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|