C19H17Br2N3O4S — CID 4533484
2-(5,7-dibromoquinolin-8-yl)oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 4533484) has the molecular formula C19H17Br2N3O4S and a molecular weight of 543.24 g/mol. Its IUPAC name is 2-(5,7-dibromoquinolin-8-yl)oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4533484 |
| Molecular Formula | C19H17Br2N3O4S |
| Molecular Weight | 543.24 g/mol |
| Exact Mass | 540.93 |
| IUPAC Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COc2c(Br)cc(Br)c3cccnc23)c1 |
| InChI | InChI=1S/C19H17Br2N3O4S/c1-24(2)29(26,27)13-6-3-5-12(9-13)23-17(25)11-28-19-16(21)10-15(20)14-7-4-8-22-18(14)19/h3-10H,11H2,1-2H3,(H,23,25) |
| InChIKey | ILFBSWYBISNFMO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |