C18H13Br2N3O4 — CID 23767883
2-(5,7-dibromoquinolin-8-yl)oxy-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 23767883) has the molecular formula C18H13Br2N3O4 and a molecular weight of 495.13 g/mol. Its IUPAC name is 2-(5,7-dibromoquinolin-8-yl)oxy-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23767883 |
| Molecular Formula | C18H13Br2N3O4 |
| Molecular Weight | 495.13 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(Br)c3cccnc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13Br2N3O4/c1-10-4-5-11(7-15(10)23(25)26)22-16(24)9-27-18-14(20)8-13(19)12-3-2-6-21-17(12)18/h2-8H,9H2,1H3,(H,22,24) |
| InChIKey | GISNHLUZVYGPFM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.13 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|