C18H15Br2NO4S — CID 35203632
(5,7-dibromoquinolin-8-yl) 5-ethyl-2-methoxybenzenesulfonate (PubChem CID 35203632) has the molecular formula C18H15Br2NO4S and a molecular weight of 501.20 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) 5-ethyl-2-methoxybenzenesulfonate.
| Compound Name | (5,7-dibromoquinolin-8-yl) 5-ethyl-2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 35203632 |
| Molecular Formula | C18H15Br2NO4S |
| Molecular Weight | 501.20 g/mol |
| Exact Mass | 498.91 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) 5-ethyl-2-methoxybenzenesulfonate |
| SMILES | CCc1ccc(OC)c(S(=O)(=O)Oc2c(Br)cc(Br)c3cccnc23)c1 |
| InChI | InChI=1S/C18H15Br2NO4S/c1-3-11-6-7-15(24-2)16(9-11)26(22,23)25-18-14(20)10-13(19)12-5-4-8-21-17(12)18/h4-10H,3H2,1-2H3 |
| InChIKey | VFJMERKTXLVMTP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.20 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|