C14H11Br3O5S — CID 138994822
(2,4,6-tribromophenyl) 2,5-dimethoxybenzenesulfonate (PubChem CID 138994822) has the molecular formula C14H11Br3O5S and a molecular weight of 531.02 g/mol. Its IUPAC name is (2,4,6-tribromophenyl) 2,5-dimethoxybenzenesulfonate.
| Compound Name | (2,4,6-tribromophenyl) 2,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 138994822 |
| Molecular Formula | C14H11Br3O5S |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 527.79 |
| IUPAC Name | (2,4,6-tribromophenyl) 2,5-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Oc2c(Br)cc(Br)cc2Br)c1 |
| InChI | InChI=1S/C14H11Br3O5S/c1-20-9-3-4-12(21-2)13(7-9)23(18,19)22-14-10(16)5-8(15)6-11(14)17/h3-7H,1-2H3 |
| InChIKey | JKQNNIGEYJLKQR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|