C14H13ClO5S — CID 172894052
(2-chlorophenyl) 2,5-dimethoxybenzenesulfonate (PubChem CID 172894052) has the molecular formula C14H13ClO5S and a molecular weight of 328.77 g/mol. Its IUPAC name is (2-chlorophenyl) 2,5-dimethoxybenzenesulfonate.
| Compound Name | (2-chlorophenyl) 2,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 172894052 |
| Molecular Formula | C14H13ClO5S |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (2-chlorophenyl) 2,5-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Oc2ccccc2Cl)c1 |
| InChI | InChI=1S/C14H13ClO5S/c1-18-10-7-8-13(19-2)14(9-10)21(16,17)20-12-6-4-3-5-11(12)15/h3-9H,1-2H3 |
| InChIKey | MNQJEQNQCVBKHR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|