About (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate
(5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate (PubChem CID 146095902) has the molecular formula C22H17Cl2NO4S
and a molecular weight of 462.35 g/mol. Its IUPAC name is (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate |
| PubChem CID | 146095902 |
| Molecular Formula | C22H17Cl2NO4S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate |
| SMILES | CCCOc1ccc(S(=O)(=O)Oc2c(Cl)cc(Cl)c3cccnc23)c2ccccc12 |
| InChI | InChI=1S/C22H17Cl2NO4S/c1-2-12-28-19-9-10-20(15-7-4-3-6-14(15)19)30(26,27)29-22-18(24)13-17(23)16-8-5-11-25-21(16)22/h3-11,13H,2,12H2,1H3 |
| InChIKey | NDOYAGPFBUWUIQ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate?
The IUPAC name of (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate (CID 146095902) is (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate.
What is the SMILES notation for (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate?
The canonical SMILES for (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate is CCCOc1ccc(S(=O)(=O)Oc2c(Cl)cc(Cl)c3cccnc23)c2ccccc12.
What is the InChIKey of (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate?
The InChIKey is NDOYAGPFBUWUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2NO4S/c1-2-12-28-19-9-10-20(15-7-4-3-6-14(15)19)30(26,27)29-22-18(24)13-17(23)16-8-5-11-25-21(16)22/h3-11,13H,2,12H2,1H3.
What are the key properties of (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate?
(5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate has a molecular weight of 462.35 g/mol, XLogP of 6.25, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dichloroquinolin-8-yl) 4-propoxynaphthalene-1-sulfonate is sourced from PubChem (CID 146095902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).