C21H31NO3S — CID 146145742
4-propoxy-N-(2,4,4-trimethylpentan-2-yl)naphthalene-1-sulfonamide (PubChem CID 146145742) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is 4-propoxy-N-(2,4,4-trimethylpentan-2-yl)naphthalene-1-sulfonamide.
| Compound Name | 4-propoxy-N-(2,4,4-trimethylpentan-2-yl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 146145742 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-propoxy-N-(2,4,4-trimethylpentan-2-yl)naphthalene-1-sulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NC(C)(C)CC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C21H31NO3S/c1-7-14-25-18-12-13-19(17-11-9-8-10-16(17)18)26(23,24)22-21(5,6)15-20(2,3)4/h8-13,22H,7,14-15H2,1-6H3 |
| InChIKey | BXTKLDINLSREKZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |