About pyridin-2-yl 4-propoxynaphthalene-1-sulfonate
pyridin-2-yl 4-propoxynaphthalene-1-sulfonate (PubChem CID 91758618) has the molecular formula C18H17NO4S
and a molecular weight of 343.40 g/mol. Its IUPAC name is pyridin-2-yl 4-propoxynaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | pyridin-2-yl 4-propoxynaphthalene-1-sulfonate |
| PubChem CID | 91758618 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | pyridin-2-yl 4-propoxynaphthalene-1-sulfonate |
| SMILES | CCCOc1ccc(S(=O)(=O)Oc2ccccn2)c2ccccc12 |
| InChI | InChI=1S/C18H17NO4S/c1-2-13-22-16-10-11-17(15-8-4-3-7-14(15)16)24(20,21)23-18-9-5-6-12-19-18/h3-12H,2,13H2,1H3 |
| InChIKey | GNWYAHOXILXLJN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-yl 4-propoxynaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl 4-propoxynaphthalene-1-sulfonate?
The IUPAC name of pyridin-2-yl 4-propoxynaphthalene-1-sulfonate (CID 91758618) is pyridin-2-yl 4-propoxynaphthalene-1-sulfonate.
What is the SMILES notation for pyridin-2-yl 4-propoxynaphthalene-1-sulfonate?
The canonical SMILES for pyridin-2-yl 4-propoxynaphthalene-1-sulfonate is CCCOc1ccc(S(=O)(=O)Oc2ccccn2)c2ccccc12.
What is the InChIKey of pyridin-2-yl 4-propoxynaphthalene-1-sulfonate?
The InChIKey is GNWYAHOXILXLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4S/c1-2-13-22-16-10-11-17(15-8-4-3-7-14(15)16)24(20,21)23-18-9-5-6-12-19-18/h3-12H,2,13H2,1H3.
What are the key properties of pyridin-2-yl 4-propoxynaphthalene-1-sulfonate?
pyridin-2-yl 4-propoxynaphthalene-1-sulfonate has a molecular weight of 343.40 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl 4-propoxynaphthalene-1-sulfonate is sourced from PubChem (CID 91758618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).