About pyridin-2-yl 4-ethoxybenzenesulfonate
pyridin-2-yl 4-ethoxybenzenesulfonate (PubChem CID 2139779) has the molecular formula C13H13NO4S
and a molecular weight of 279.32 g/mol. Its IUPAC name is pyridin-2-yl 4-ethoxybenzenesulfonate.
Molecular Properties
| Compound Name | pyridin-2-yl 4-ethoxybenzenesulfonate |
| PubChem CID | 2139779 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | pyridin-2-yl 4-ethoxybenzenesulfonate |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2ccccn2)cc1 |
| InChI | InChI=1S/C13H13NO4S/c1-2-17-11-6-8-12(9-7-11)19(15,16)18-13-5-3-4-10-14-13/h3-10H,2H2,1H3 |
| InChIKey | HGVBIGLVICZBPD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-yl 4-ethoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl 4-ethoxybenzenesulfonate?
The IUPAC name of pyridin-2-yl 4-ethoxybenzenesulfonate (CID 2139779) is pyridin-2-yl 4-ethoxybenzenesulfonate.
What is the SMILES notation for pyridin-2-yl 4-ethoxybenzenesulfonate?
The canonical SMILES for pyridin-2-yl 4-ethoxybenzenesulfonate is CCOc1ccc(S(=O)(=O)Oc2ccccn2)cc1.
What is the InChIKey of pyridin-2-yl 4-ethoxybenzenesulfonate?
The InChIKey is HGVBIGLVICZBPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S/c1-2-17-11-6-8-12(9-7-11)19(15,16)18-13-5-3-4-10-14-13/h3-10H,2H2,1H3.
What are the key properties of pyridin-2-yl 4-ethoxybenzenesulfonate?
pyridin-2-yl 4-ethoxybenzenesulfonate has a molecular weight of 279.32 g/mol, XLogP of 2.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl 4-ethoxybenzenesulfonate is sourced from PubChem (CID 2139779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).