About naphthalen-2-yl 4-ethoxybenzenesulfonate
naphthalen-2-yl 4-ethoxybenzenesulfonate (PubChem CID 5017326) has the molecular formula C18H16O4S
and a molecular weight of 328.39 g/mol. Its IUPAC name is naphthalen-2-yl 4-ethoxybenzenesulfonate.
Molecular Properties
| Compound Name | naphthalen-2-yl 4-ethoxybenzenesulfonate |
| PubChem CID | 5017326 |
| Molecular Formula | C18H16O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | naphthalen-2-yl 4-ethoxybenzenesulfonate |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C18H16O4S/c1-2-21-16-9-11-18(12-10-16)23(19,20)22-17-8-7-14-5-3-4-6-15(14)13-17/h3-13H,2H2,1H3 |
| InChIKey | OVUCZZYNAQJXNR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl 4-ethoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl 4-ethoxybenzenesulfonate?
The IUPAC name of naphthalen-2-yl 4-ethoxybenzenesulfonate (CID 5017326) is naphthalen-2-yl 4-ethoxybenzenesulfonate.
What is the SMILES notation for naphthalen-2-yl 4-ethoxybenzenesulfonate?
The canonical SMILES for naphthalen-2-yl 4-ethoxybenzenesulfonate is CCOc1ccc(S(=O)(=O)Oc2ccc3ccccc3c2)cc1.
What is the InChIKey of naphthalen-2-yl 4-ethoxybenzenesulfonate?
The InChIKey is OVUCZZYNAQJXNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O4S/c1-2-21-16-9-11-18(12-10-16)23(19,20)22-17-8-7-14-5-3-4-6-15(14)13-17/h3-13H,2H2,1H3.
What are the key properties of naphthalen-2-yl 4-ethoxybenzenesulfonate?
naphthalen-2-yl 4-ethoxybenzenesulfonate has a molecular weight of 328.39 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl 4-ethoxybenzenesulfonate is sourced from PubChem (CID 5017326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).