About ethoxyethane;2-ethoxynaphthalene
ethoxyethane;2-ethoxynaphthalene (PubChem CID 118982387) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is ethoxyethane;2-ethoxynaphthalene.
Molecular Properties
| Compound Name | ethoxyethane;2-ethoxynaphthalene |
| PubChem CID | 118982387 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | ethoxyethane;2-ethoxynaphthalene |
| SMILES | CCOCC.CCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H12O.C4H10O/c1-2-13-12-8-7-10-5-3-4-6-11(10)9-12;1-3-5-4-2/h3-9H,2H2,1H3;3-4H2,1-2H3 |
| InChIKey | OZXNZJIQEOTDGL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethoxyethane;2-ethoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;2-ethoxynaphthalene?
The IUPAC name of ethoxyethane;2-ethoxynaphthalene (CID 118982387) is ethoxyethane;2-ethoxynaphthalene.
What is the SMILES notation for ethoxyethane;2-ethoxynaphthalene?
The canonical SMILES for ethoxyethane;2-ethoxynaphthalene is CCOCC.CCOc1ccc2ccccc2c1.
What is the InChIKey of ethoxyethane;2-ethoxynaphthalene?
The InChIKey is OZXNZJIQEOTDGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O.C4H10O/c1-2-13-12-8-7-10-5-3-4-6-11(10)9-12;1-3-5-4-2/h3-9H,2H2,1H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;2-ethoxynaphthalene?
ethoxyethane;2-ethoxynaphthalene has a molecular weight of 246.35 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;2-ethoxynaphthalene is sourced from PubChem (CID 118982387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).