About ethoxyethane;phenanthrene
ethoxyethane;phenanthrene (PubChem CID 174652079) has the molecular formula C18H20O
and a molecular weight of 252.36 g/mol. Its IUPAC name is ethoxyethane;phenanthrene.
Molecular Properties
| Compound Name | ethoxyethane;phenanthrene |
| PubChem CID | 174652079 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | ethoxyethane;phenanthrene |
| SMILES | CCOCC.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C4H10O/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-5-4-2/h1-10H;3-4H2,1-2H3 |
| InChIKey | GEMUVNQFZNNIPH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;phenanthrene?
The IUPAC name of ethoxyethane;phenanthrene (CID 174652079) is ethoxyethane;phenanthrene.
What is the SMILES notation for ethoxyethane;phenanthrene?
The canonical SMILES for ethoxyethane;phenanthrene is CCOCC.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of ethoxyethane;phenanthrene?
The InChIKey is GEMUVNQFZNNIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C4H10O/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-5-4-2/h1-10H;3-4H2,1-2H3.
What are the key properties of ethoxyethane;phenanthrene?
ethoxyethane;phenanthrene has a molecular weight of 252.36 g/mol, XLogP of 5.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;phenanthrene is sourced from PubChem (CID 174652079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).