About 1-ethoxyphenanthrene
1-ethoxyphenanthrene (PubChem CID 19828992) has the molecular formula C16H14O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-ethoxyphenanthrene.
Molecular Properties
| Compound Name | 1-ethoxyphenanthrene |
| PubChem CID | 19828992 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-ethoxyphenanthrene |
| SMILES | CCOc1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C16H14O/c1-2-17-16-9-5-8-14-13-7-4-3-6-12(13)10-11-15(14)16/h3-11H,2H2,1H3 |
| InChIKey | FONRFZLFNDUTOW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyphenanthrene?
The IUPAC name of 1-ethoxyphenanthrene (CID 19828992) is 1-ethoxyphenanthrene.
What is the SMILES notation for 1-ethoxyphenanthrene?
The canonical SMILES for 1-ethoxyphenanthrene is CCOc1cccc2c1ccc1ccccc12.
What is the InChIKey of 1-ethoxyphenanthrene?
The InChIKey is FONRFZLFNDUTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O/c1-2-17-16-9-5-8-14-13-7-4-3-6-12(13)10-11-15(14)16/h3-11H,2H2,1H3.
What are the key properties of 1-ethoxyphenanthrene?
1-ethoxyphenanthrene has a molecular weight of 222.29 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyphenanthrene is sourced from PubChem (CID 19828992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).