About 1,7-diethoxynaphthalene
1,7-diethoxynaphthalene (PubChem CID 13359547) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1,7-diethoxynaphthalene.
Molecular Properties
| Compound Name | 1,7-diethoxynaphthalene |
| PubChem CID | 13359547 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1,7-diethoxynaphthalene |
| SMILES | CCOc1ccc2cccc(OCC)c2c1 |
| InChI | InChI=1S/C14H16O2/c1-3-15-12-9-8-11-6-5-7-14(16-4-2)13(11)10-12/h5-10H,3-4H2,1-2H3 |
| InChIKey | XPTCIPWPSSKEIO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7-diethoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-diethoxynaphthalene?
The IUPAC name of 1,7-diethoxynaphthalene (CID 13359547) is 1,7-diethoxynaphthalene.
What is the SMILES notation for 1,7-diethoxynaphthalene?
The canonical SMILES for 1,7-diethoxynaphthalene is CCOc1ccc2cccc(OCC)c2c1.
What is the InChIKey of 1,7-diethoxynaphthalene?
The InChIKey is XPTCIPWPSSKEIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-3-15-12-9-8-11-6-5-7-14(16-4-2)13(11)10-12/h5-10H,3-4H2,1-2H3.
What are the key properties of 1,7-diethoxynaphthalene?
1,7-diethoxynaphthalene has a molecular weight of 216.28 g/mol, XLogP of 3.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-diethoxynaphthalene is sourced from PubChem (CID 13359547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).