About 2,6-diethoxyanthracene
2,6-diethoxyanthracene (PubChem CID 12651989) has the molecular formula C18H18O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2,6-diethoxyanthracene.
Molecular Properties
| Compound Name | 2,6-diethoxyanthracene |
| PubChem CID | 12651989 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2,6-diethoxyanthracene |
| SMILES | CCOc1ccc2cc3cc(OCC)ccc3cc2c1 |
| InChI | InChI=1S/C18H18O2/c1-3-19-17-7-5-13-10-16-12-18(20-4-2)8-6-14(16)9-15(13)11-17/h5-12H,3-4H2,1-2H3 |
| InChIKey | RNYYXGXKYLQBCV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diethoxyanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethoxyanthracene?
The IUPAC name of 2,6-diethoxyanthracene (CID 12651989) is 2,6-diethoxyanthracene.
What is the SMILES notation for 2,6-diethoxyanthracene?
The canonical SMILES for 2,6-diethoxyanthracene is CCOc1ccc2cc3cc(OCC)ccc3cc2c1.
What is the InChIKey of 2,6-diethoxyanthracene?
The InChIKey is RNYYXGXKYLQBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2/c1-3-19-17-7-5-13-10-16-12-18(20-4-2)8-6-14(16)9-15(13)11-17/h5-12H,3-4H2,1-2H3.
What are the key properties of 2,6-diethoxyanthracene?
2,6-diethoxyanthracene has a molecular weight of 266.34 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethoxyanthracene is sourced from PubChem (CID 12651989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).