About 7-ethoxy-2-iodoquinoline
7-ethoxy-2-iodoquinoline (PubChem CID 133063492) has the molecular formula C11H10INO
and a molecular weight of 299.11 g/mol. Its IUPAC name is 7-ethoxy-2-iodoquinoline.
Molecular Properties
| Compound Name | 7-ethoxy-2-iodoquinoline |
| PubChem CID | 133063492 |
| Molecular Formula | C11H10INO |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 7-ethoxy-2-iodoquinoline |
| SMILES | CCOc1ccc2ccc(I)nc2c1 |
| InChI | InChI=1S/C11H10INO/c1-2-14-9-5-3-8-4-6-11(12)13-10(8)7-9/h3-7H,2H2,1H3 |
| InChIKey | QZHUVQZSXZELIU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxy-2-iodoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-2-iodoquinoline?
The IUPAC name of 7-ethoxy-2-iodoquinoline (CID 133063492) is 7-ethoxy-2-iodoquinoline.
What is the SMILES notation for 7-ethoxy-2-iodoquinoline?
The canonical SMILES for 7-ethoxy-2-iodoquinoline is CCOc1ccc2ccc(I)nc2c1.
What is the InChIKey of 7-ethoxy-2-iodoquinoline?
The InChIKey is QZHUVQZSXZELIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10INO/c1-2-14-9-5-3-8-4-6-11(12)13-10(8)7-9/h3-7H,2H2,1H3.
What are the key properties of 7-ethoxy-2-iodoquinoline?
7-ethoxy-2-iodoquinoline has a molecular weight of 299.11 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-2-iodoquinoline is sourced from PubChem (CID 133063492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).