C24H24O4 — CID 162064301
1,6-diethoxynaphthalene;naphthalene-1,6-diol (PubChem CID 162064301) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 1,6-diethoxynaphthalene;naphthalene-1,6-diol.
| Compound Name | 1,6-diethoxynaphthalene;naphthalene-1,6-diol |
|---|---|
| PubChem CID | 162064301 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1,6-diethoxynaphthalene;naphthalene-1,6-diol |
| SMILES | CCOc1ccc2c(OCC)cccc2c1.Oc1ccc2c(O)cccc2c1 |
| InChI | InChI=1S/C14H16O2.C10H8O2/c1-3-15-12-8-9-13-11(10-12)6-5-7-14(13)16-4-2;11-8-4-5-9-7(6-8)2-1-3-10(9)12/h5-10H,3-4H2,1-2H3;1-6,11-12H |
| InChIKey | ZAGFPNLVCHDGCH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |